C20H21FN6O — CID 137458870
(6R)-9-fluoro-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one (PubChem CID 137458870) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is (6R)-9-fluoro-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one.
| Compound Name | (6R)-9-fluoro-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
|---|---|
| PubChem CID | 137458870 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (6R)-9-fluoro-2,11,17,21,22,25-hexazapentacyclo[17.5.2.02,6.07,12.022,26]hexacosa-1(25),7(12),8,10,19(26),20,23-heptaen-18-one |
| SMILES | O=C1NCCCCc2ncc(F)cc2[C@H]2CCCN2c2ccn3ncc1c3n2 |
| InChI | InChI=1S/C20H21FN6O/c21-13-10-14-16(23-11-13)4-1-2-7-22-20(28)15-12-24-27-9-6-18(25-19(15)27)26-8-3-5-17(14)26/h6,9-12,17H,1-5,7-8H2,(H,22,28)/t17-/m1/s1 |
| InChIKey | COFVTKKTPFIGHL-QGZVFWFLSA-N |
| XLogP | 2.67 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |