About 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide
2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide (PubChem CID 137459279) has the molecular formula C5H8N2O3S2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 137459279 |
| Molecular Formula | C5H8N2O3S2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide |
| SMILES | CC(O)c1ncc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C5H8N2O3S2/c1-3(8)5-7-2-4(11-5)12(6,9)10/h2-3,8H,1H3,(H2,6,9,10) |
| InChIKey | XPTKUALWPLTYOV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide (CID 137459279) is 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide is CC(O)c1ncc(S(N)(=O)=O)s1.
What is the InChIKey of 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide?
The InChIKey is XPTKUALWPLTYOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3S2/c1-3(8)5-7-2-4(11-5)12(6,9)10/h2-3,8H,1H3,(H2,6,9,10).
What are the key properties of 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide?
2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide has a molecular weight of 208.26 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxyethyl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 137459279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).