About 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one
3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one (PubChem CID 13746) has the molecular formula C10H12N3O4PS
and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one.
Molecular Properties
| Compound Name | 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one |
| PubChem CID | 13746 |
| Molecular Formula | C10H12N3O4PS |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one |
| SMILES | COP(=O)(OC)SCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C10H12N3O4PS/c1-16-18(15,17-2)19-7-13-10(14)8-5-3-4-6-9(8)11-12-13/h3-6H,7H2,1-2H3 |
| InChIKey | NYHRHBKYEVSBHJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one?
The IUPAC name of 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one (CID 13746) is 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one.
What is the SMILES notation for 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one?
The canonical SMILES for 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one is COP(=O)(OC)SCn1nnc2ccccc2c1=O.
What is the InChIKey of 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one?
The InChIKey is NYHRHBKYEVSBHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N3O4PS/c1-16-18(15,17-2)19-7-13-10(14)8-5-3-4-6-9(8)11-12-13/h3-6H,7H2,1-2H3.
What are the key properties of 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one?
3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one has a molecular weight of 301.26 g/mol, XLogP of 1.88, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethoxyphosphorylsulfanylmethyl)-1,2,3-benzotriazin-4-one is sourced from PubChem (CID 13746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).