About N,N-diformamidopropanamide
N,N-diformamidopropanamide (PubChem CID 137460075) has the molecular formula C5H9N3O3
and a molecular weight of 159.15 g/mol. Its IUPAC name is N,N-diformamidopropanamide.
Molecular Properties
| Compound Name | N,N-diformamidopropanamide |
| PubChem CID | 137460075 |
| Molecular Formula | C5H9N3O3 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | N,N-diformamidopropanamide |
| SMILES | CCC(=O)N(NC=O)NC=O |
| InChI | InChI=1S/C5H9N3O3/c1-2-5(11)8(6-3-9)7-4-10/h3-4H,2H2,1H3,(H,6,9)(H,7,10) |
| InChIKey | QJMOKZSOSMEIOF-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diformamidopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diformamidopropanamide?
The IUPAC name of N,N-diformamidopropanamide (CID 137460075) is N,N-diformamidopropanamide.
What is the SMILES notation for N,N-diformamidopropanamide?
The canonical SMILES for N,N-diformamidopropanamide is CCC(=O)N(NC=O)NC=O.
What is the InChIKey of N,N-diformamidopropanamide?
The InChIKey is QJMOKZSOSMEIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O3/c1-2-5(11)8(6-3-9)7-4-10/h3-4H,2H2,1H3,(H,6,9)(H,7,10).
What are the key properties of N,N-diformamidopropanamide?
N,N-diformamidopropanamide has a molecular weight of 159.15 g/mol, XLogP of -1.45, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diformamidopropanamide is sourced from PubChem (CID 137460075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).