About [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride
[5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride (PubChem CID 137460361) has the molecular formula C13H16ClN3O
and a molecular weight of 265.74 g/mol. Its IUPAC name is [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride |
| PubChem CID | 137460361 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1OCCc2c(-c3ncc[nH]3)cccc21 |
| InChI | InChI=1S/C13H15N3O.ClH/c14-8-12-10-2-1-3-11(9(10)4-7-17-12)13-15-5-6-16-13;/h1-3,5-6,12H,4,7-8,14H2,(H,15,16);1H |
| InChIKey | JHQZNSDKJBMOMM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride?
The IUPAC name of [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride (CID 137460361) is [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride.
What is the SMILES notation for [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride?
The canonical SMILES for [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride is Cl.NCC1OCCc2c(-c3ncc[nH]3)cccc21.
What is the InChIKey of [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride?
The InChIKey is JHQZNSDKJBMOMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O.ClH/c14-8-12-10-2-1-3-11(9(10)4-7-17-12)13-15-5-6-16-13;/h1-3,5-6,12H,4,7-8,14H2,(H,15,16);1H.
What are the key properties of [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride?
[5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride has a molecular weight of 265.74 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1H-imidazol-2-yl)-3,4-dihydro-1H-isochromen-1-yl]methanamine;hydrochloride is sourced from PubChem (CID 137460361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).