About [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine
[(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine (PubChem CID 137460556) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine.
Molecular Properties
| Compound Name | [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine |
| PubChem CID | 137460556 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine |
| SMILES | NC[C@H]1OCCc2ccc(-c3ccncc3)cc21 |
| InChI | InChI=1S/C15H16N2O/c16-10-15-14-9-13(11-3-6-17-7-4-11)2-1-12(14)5-8-18-15/h1-4,6-7,9,15H,5,8,10,16H2/t15-/m1/s1 |
| InChIKey | XDKWXHYWJVWZEO-OAHLLOKOSA-N |
| XLogP | 2.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine?
The IUPAC name of [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine (CID 137460556) is [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine.
What is the SMILES notation for [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine?
The canonical SMILES for [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine is NC[C@H]1OCCc2ccc(-c3ccncc3)cc21.
What is the InChIKey of [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine?
The InChIKey is XDKWXHYWJVWZEO-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H16N2O/c16-10-15-14-9-13(11-3-6-17-7-4-11)2-1-12(14)5-8-18-15/h1-4,6-7,9,15H,5,8,10,16H2/t15-/m1/s1.
What are the key properties of [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine?
[(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine has a molecular weight of 240.31 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-7-pyridin-4-yl-3,4-dihydro-1H-isochromen-1-yl]methanamine is sourced from PubChem (CID 137460556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).