C16H22BrFN2O2 — CID 137460966
tert-butyl 3-amino-2-[(3-bromo-2-fluorophenyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 137460966) has the molecular formula C16H22BrFN2O2 and a molecular weight of 373.27 g/mol. Its IUPAC name is tert-butyl 3-amino-2-[(3-bromo-2-fluorophenyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-amino-2-[(3-bromo-2-fluorophenyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 137460966 |
| Molecular Formula | C16H22BrFN2O2 |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | tert-butyl 3-amino-2-[(3-bromo-2-fluorophenyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)C1Cc1cccc(Br)c1F |
| InChI | InChI=1S/C16H22BrFN2O2/c1-16(2,3)22-15(21)20-8-7-12(19)13(20)9-10-5-4-6-11(17)14(10)18/h4-6,12-13H,7-9,19H2,1-3H3 |
| InChIKey | IOVHPIVFYMHWBX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |