C28H19Cl2F6NO4 — CID 137462393
(1S,5S)-3-(3,5-dichlorophenyl)-1-methyl-6,6-bis[4-(1,1,2-trifluoroethoxy)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 137462393) has the molecular formula C28H19Cl2F6NO4 and a molecular weight of 618.36 g/mol. Its IUPAC name is (1S,5S)-3-(3,5-dichlorophenyl)-1-methyl-6,6-bis[4-(1,1,2-trifluoroethoxy)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | (1S,5S)-3-(3,5-dichlorophenyl)-1-methyl-6,6-bis[4-(1,1,2-trifluoroethoxy)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 137462393 |
| Molecular Formula | C28H19Cl2F6NO4 |
| Molecular Weight | 618.36 g/mol |
| Exact Mass | 617.06 |
| IUPAC Name | (1S,5S)-3-(3,5-dichlorophenyl)-1-methyl-6,6-bis[4-(1,1,2-trifluoroethoxy)phenyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | C[C@]12C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)[C@H]1C2(c1ccc(OC(F)(F)CF)cc1)c1ccc(OC(F)(F)CF)cc1 |
| InChI | InChI=1S/C28H19Cl2F6NO4/c1-25-22(23(38)37(24(25)39)19-11-17(29)10-18(30)12-19)28(25,15-2-6-20(7-3-15)40-26(33,34)13-31)16-4-8-21(9-5-16)41-27(35,36)14-32/h2-12,22H,13-14H2,1H3/t22-,25-/m1/s1 |
| InChIKey | CYNFFPQWXKSOOO-RCZVLFRGSA-N |
| XLogP | 7.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.36 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|