About N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide
N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 137462539) has the molecular formula C21H14F3N3O3S
and a molecular weight of 445.42 g/mol. Its IUPAC name is N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide.
Molecular Properties
| Compound Name | N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide |
| PubChem CID | 137462539 |
| Molecular Formula | C21H14F3N3O3S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | COc1ncc(-c2ccccc2)c2sc(NC(=O)c3ccc(OC(F)(F)F)cc3)nc12 |
| InChI | InChI=1S/C21H14F3N3O3S/c1-29-19-16-17(15(11-25-19)12-5-3-2-4-6-12)31-20(26-16)27-18(28)13-7-9-14(10-8-13)30-21(22,23)24/h2-11H,1H3,(H,26,27,28) |
| InChIKey | PYDBSTDYFSRCKP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide?
The IUPAC name of N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide (CID 137462539) is N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide.
What is the SMILES notation for N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide?
The canonical SMILES for N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide is COc1ncc(-c2ccccc2)c2sc(NC(=O)c3ccc(OC(F)(F)F)cc3)nc12.
What is the InChIKey of N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide?
The InChIKey is PYDBSTDYFSRCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F3N3O3S/c1-29-19-16-17(15(11-25-19)12-5-3-2-4-6-12)31-20(26-16)27-18(28)13-7-9-14(10-8-13)30-21(22,23)24/h2-11H,1H3,(H,26,27,28).
What are the key properties of N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide?
N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide has a molecular weight of 445.42 g/mol, XLogP of 5.52, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-7-phenyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-4-(trifluoromethoxy)benzamide is sourced from PubChem (CID 137462539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).