C23H25NO4 — CID 137462792
2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-4-phenylbutanoic acid (PubChem CID 137462792) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-4-phenylbutanoic acid.
| Compound Name | 2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 137462792 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-4-phenylbutanoic acid |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)OC(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H25NO4/c25-22(26)20(13-12-15-6-2-1-3-7-15)28-23(27)24-21-18-10-4-8-16(18)14-17-9-5-11-19(17)21/h1-3,6-7,14,20H,4-5,8-13H2,(H,24,27)(H,25,26) |
| InChIKey | LCASIMZLFVDJOE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |