About [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid
[(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid (PubChem CID 137462852) has the molecular formula C11H11F3N2O3
and a molecular weight of 276.21 g/mol. Its IUPAC name is [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid.
Molecular Properties
| Compound Name | [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid |
| PubChem CID | 137462852 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid |
| SMILES | CC(O)/C(=N/N(C)C(=O)O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H11F3N2O3/c1-5(17)10(15-16(2)11(18)19)6-3-7(12)9(14)8(13)4-6/h3-5,17H,1-2H3,(H,18,19)/b15-10- |
| InChIKey | GLZHVQZPHXYUCO-GDNBJRDFSA-N |
| XLogP | 1.80 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid?
The IUPAC name of [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid (CID 137462852) is [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid.
What is the SMILES notation for [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid?
The canonical SMILES for [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid is CC(O)/C(=N/N(C)C(=O)O)c1cc(F)c(F)c(F)c1.
What is the InChIKey of [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid?
The InChIKey is GLZHVQZPHXYUCO-GDNBJRDFSA-N. The full InChI is InChI=1S/C11H11F3N2O3/c1-5(17)10(15-16(2)11(18)19)6-3-7(12)9(14)8(13)4-6/h3-5,17H,1-2H3,(H,18,19)/b15-10-.
What are the key properties of [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid?
[(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid has a molecular weight of 276.21 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2-hydroxy-1-(3,4,5-trifluorophenyl)propylidene]amino]-methylcarbamic acid is sourced from PubChem (CID 137462852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).