C16H8F6N2O2 — CID 137462910
5-[3-(trifluoromethyl)-4-(3,4,5-trifluorophenyl)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one (PubChem CID 137462910) has the molecular formula C16H8F6N2O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)-4-(3,4,5-trifluorophenyl)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one.
| Compound Name | 5-[3-(trifluoromethyl)-4-(3,4,5-trifluorophenyl)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 137462910 |
| Molecular Formula | C16H8F6N2O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 5-[3-(trifluoromethyl)-4-(3,4,5-trifluorophenyl)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one |
| SMILES | O=C1NN=C(c2ccc(-c3cc(F)c(F)c(F)c3)c(C(F)(F)F)c2)CO1 |
| InChI | InChI=1S/C16H8F6N2O2/c17-11-4-8(5-12(18)14(11)19)9-2-1-7(3-10(9)16(20,21)22)13-6-26-15(25)24-23-13/h1-5H,6H2,(H,24,25) |
| InChIKey | JFMCGGKNFAUHRJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|