C16H11F4N3O3 — CID 137463056
5-[4-(3-amino-4-fluorophenyl)-3-(trifluoromethoxy)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one (PubChem CID 137463056) has the molecular formula C16H11F4N3O3 and a molecular weight of 369.27 g/mol. Its IUPAC name is 5-[4-(3-amino-4-fluorophenyl)-3-(trifluoromethoxy)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one.
| Compound Name | 5-[4-(3-amino-4-fluorophenyl)-3-(trifluoromethoxy)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 137463056 |
| Molecular Formula | C16H11F4N3O3 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 5-[4-(3-amino-4-fluorophenyl)-3-(trifluoromethoxy)phenyl]-3,6-dihydro-1,3,4-oxadiazin-2-one |
| SMILES | Nc1cc(-c2ccc(C3=NNC(=O)OC3)cc2OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C16H11F4N3O3/c17-11-4-2-8(5-12(11)21)10-3-1-9(6-14(10)26-16(18,19)20)13-7-25-15(24)23-22-13/h1-6H,7,21H2,(H,23,24) |
| InChIKey | NNQKLHINZCYRDE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|