C16H14FN3O3 — CID 137463496
1-[6-[(5-fluoropyridine-3-carbonyl)amino]-3-pyridinyl]cyclobutane-1-carboxylic acid (PubChem CID 137463496) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-[6-[(5-fluoropyridine-3-carbonyl)amino]-3-pyridinyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[6-[(5-fluoropyridine-3-carbonyl)amino]-3-pyridinyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 137463496 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[6-[(5-fluoropyridine-3-carbonyl)amino]-3-pyridinyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(C2(C(=O)O)CCC2)cn1)c1cncc(F)c1 |
| InChI | InChI=1S/C16H14FN3O3/c17-12-6-10(7-18-9-12)14(21)20-13-3-2-11(8-19-13)16(15(22)23)4-1-5-16/h2-3,6-9H,1,4-5H2,(H,22,23)(H,19,20,21) |
| InChIKey | OSDSRXPHLYXHLC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |