C23H29ClN10O3S — CID 137464973
2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-1-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 137464973) has the molecular formula C23H29ClN10O3S and a molecular weight of 561.07 g/mol. Its IUPAC name is 2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-1-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-1-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137464973 |
| Molecular Formula | C23H29ClN10O3S |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | 2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-1-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)[C@H](CCCCN=C(N)N)NC(=O)c1csc([C@@H]2C[C@@H](N)CN2C(=O)c2cn3cc(Cl)ccc3n2)n1 |
| InChI | InChI=1S/C23H29ClN10O3S/c24-12-4-5-18-30-15(10-33(18)8-12)22(37)34-9-13(25)7-17(34)21-32-16(11-38-21)20(36)31-14(19(26)35)3-1-2-6-29-23(27)28/h4-5,8,10-11,13-14,17H,1-3,6-7,9,25H2,(H2,26,35)(H,31,36)(H4,27,28,29)/t13-,14+,17+/m1/s1 |
| InChIKey | YGODCUSSYXRBRZ-KEYYUXOJSA-N |
| XLogP | 0.39 |
| TPSA | 213.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|