C27H34N8O3S — CID 137464976
2-[(2S,4R)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 137464976) has the molecular formula C27H34N8O3S and a molecular weight of 550.69 g/mol. Its IUPAC name is 2-[(2S,4R)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2S,4R)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137464976 |
| Molecular Formula | C27H34N8O3S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 2-[(2S,4R)-4-amino-1-(naphthalene-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)[C@H](CCCCN=C(N)N)NC(=O)c1csc([C@@H]2C[C@@H](N)CN2C(=O)c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C27H34N8O3S/c1-31-23(36)20(8-4-5-11-32-27(29)30)33-24(37)21-15-39-25(34-21)22-13-19(28)14-35(22)26(38)18-10-9-16-6-2-3-7-17(16)12-18/h2-3,6-7,9-10,12,15,19-20,22H,4-5,8,11,13-14,28H2,1H3,(H,31,36)(H,33,37)(H4,29,30,32)/t19-,20+,22+/m1/s1 |
| InChIKey | BXOSIXVQJVFKRG-URVUXULASA-N |
| XLogP | 1.50 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|