C24H32N10O3S — CID 137465046
2-[(2S,4R)-4-amino-1-(imidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 137465046) has the molecular formula C24H32N10O3S and a molecular weight of 540.65 g/mol. Its IUPAC name is 2-[(2S,4R)-4-amino-1-(imidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2S,4R)-4-amino-1-(imidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137465046 |
| Molecular Formula | C24H32N10O3S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-[(2S,4R)-4-amino-1-(imidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[(2S)-6-(diaminomethylideneamino)-1-(methylamino)-1-oxohexan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)[C@H](CCCCN=C(N)N)NC(=O)c1csc([C@@H]2C[C@@H](N)CN2C(=O)c2cn3ccccc3n2)n1 |
| InChI | InChI=1S/C24H32N10O3S/c1-28-20(35)15(6-2-4-8-29-24(26)27)31-21(36)17-13-38-22(32-17)18-10-14(25)11-34(18)23(37)16-12-33-9-5-3-7-19(33)30-16/h3,5,7,9,12-15,18H,2,4,6,8,10-11,25H2,1H3,(H,28,35)(H,31,36)(H4,26,27,29)/t14-,15+,18+/m1/s1 |
| InChIKey | IQXORBRTZBSKJQ-VKJFTORMSA-N |
| XLogP | -0.01 |
| TPSA | 199.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|