C22H28ClN9O2S — CID 137465077
2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[5-(diaminomethylideneamino)pentyl]-1,3-thiazole-4-carboxamide (PubChem CID 137465077) has the molecular formula C22H28ClN9O2S and a molecular weight of 518.05 g/mol. Its IUPAC name is 2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[5-(diaminomethylideneamino)pentyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[5-(diaminomethylideneamino)pentyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 137465077 |
| Molecular Formula | C22H28ClN9O2S |
| Molecular Weight | 518.05 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-N-[5-(diaminomethylideneamino)pentyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(N)=NCCCCCNC(=O)c1csc([C@@H]2C[C@@H](N)CN2C(=O)c2cn3cc(Cl)ccc3n2)n1 |
| InChI | InChI=1S/C22H28ClN9O2S/c23-13-4-5-18-29-15(11-31(18)9-13)21(34)32-10-14(24)8-17(32)20-30-16(12-35-20)19(33)27-6-2-1-3-7-28-22(25)26/h4-5,9,11-12,14,17H,1-3,6-8,10,24H2,(H,27,33)(H4,25,26,28)/t14-,17+/m1/s1 |
| InChIKey | KBCPCNVORWUACK-PBHICJAKSA-N |
| XLogP | 1.53 |
| TPSA | 170.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.05 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|