C23H28ClN9O4S — CID 137465110
(2S)-2-[[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-6-(diaminomethylideneamino)hexanoic acid (PubChem CID 137465110) has the molecular formula C23H28ClN9O4S and a molecular weight of 562.06 g/mol. Its IUPAC name is (2S)-2-[[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | (2S)-2-[[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 137465110 |
| Molecular Formula | C23H28ClN9O4S |
| Molecular Weight | 562.06 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | (2S)-2-[[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazole-4-carbonyl]amino]-6-(diaminomethylideneamino)hexanoic acid |
| SMILES | NC(N)=NCCCC[C@H](NC(=O)c1csc([C@@H]2C[C@@H](N)CN2C(=O)c2cn3cc(Cl)ccc3n2)n1)C(=O)O |
| InChI | InChI=1S/C23H28ClN9O4S/c24-12-4-5-18-29-15(10-32(18)8-12)21(35)33-9-13(25)7-17(33)20-31-16(11-38-20)19(34)30-14(22(36)37)3-1-2-6-28-23(26)27/h4-5,8,10-11,13-14,17H,1-3,6-7,9,25H2,(H,30,34)(H,36,37)(H4,26,27,28)/t13-,14+,17+/m1/s1 |
| InChIKey | KXJUMARQSGTPDT-KEYYUXOJSA-N |
| XLogP | 0.99 |
| TPSA | 207.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.06 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|