C17H20F3N5O — CID 137465390
N'-(1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridin-6-yl)-2-[2-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 137465390) has the molecular formula C17H20F3N5O and a molecular weight of 367.38 g/mol. Its IUPAC name is N'-(1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridin-6-yl)-2-[2-(trifluoromethyl)phenyl]acetohydrazide.
| Compound Name | N'-(1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridin-6-yl)-2-[2-(trifluoromethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 137465390 |
| Molecular Formula | C17H20F3N5O |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N'-(1,3-dimethyl-4,5,6,7-tetrahydropyrazolo[5,4-b]pyridin-6-yl)-2-[2-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | Cc1nn(C)c2c1CCC(NNC(=O)Cc1ccccc1C(F)(F)F)N2 |
| InChI | InChI=1S/C17H20F3N5O/c1-10-12-7-8-14(21-16(12)25(2)24-10)22-23-15(26)9-11-5-3-4-6-13(11)17(18,19)20/h3-6,14,21-22H,7-9H2,1-2H3,(H,23,26) |
| InChIKey | ALTFYOFWHZHQDN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|