C11H11N — CID 137465920
(3-propa-1,2-dienylcyclohepta-2,4,6-trien-1-yl)methanimine (PubChem CID 137465920) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is (3-propa-1,2-dienylcyclohepta-2,4,6-trien-1-yl)methanimine.
| Compound Name | (3-propa-1,2-dienylcyclohepta-2,4,6-trien-1-yl)methanimine |
|---|---|
| PubChem CID | 137465920 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (3-propa-1,2-dienylcyclohepta-2,4,6-trien-1-yl)methanimine |
| SMILES | [H]/N=C/C1C=CC=CC(C=C=C)=C1 |
| InChI | InChI=1S/C11H11N/c1-2-5-10-6-3-4-7-11(8-10)9-12/h3-9,11-12H,1H2/b12-9+ |
| InChIKey | BPTMDDIIWRDUSK-FMIVXFBMSA-N |
| XLogP | 2.65 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|