C23H35N5O3S2 — CID 137466152
N-[3-methyl-4-[5-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]cyclopropanesulfonamide (PubChem CID 137466152) has the molecular formula C23H35N5O3S2 and a molecular weight of 493.70 g/mol. Its IUPAC name is N-[3-methyl-4-[5-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]cyclopropanesulfonamide.
| Compound Name | N-[3-methyl-4-[5-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 137466152 |
| Molecular Formula | C23H35N5O3S2 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[3-methyl-4-[5-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]cyclopropanesulfonamide |
| SMILES | CC1CC(NS(=O)(=O)C2CC2)CC1c1cnc2cnc3c(ccn3COCCS(C)(C)C)n12 |
| InChI | InChI=1S/C23H35N5O3S2/c1-16-11-17(26-33(29,30)18-5-6-18)12-19(16)21-13-24-22-14-25-23-20(28(21)22)7-8-27(23)15-31-9-10-32(2,3)4/h7-8,13-14,16-19,26H,5-6,9-12,15H2,1-4H3 |
| InChIKey | PRNSXNAMSXRGEW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|