About 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole
1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole (PubChem CID 137466163) has the molecular formula C21H22N4
and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole.
Molecular Properties
| Compound Name | 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole |
| PubChem CID | 137466163 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole |
| SMILES | c1ccc(CN2CCCC(n3[nH]cc4ccc5nccc5c43)C2)cc1 |
| InChI | InChI=1S/C21H22N4/c1-2-5-16(6-3-1)14-24-12-4-7-18(15-24)25-21-17(13-23-25)8-9-20-19(21)10-11-22-20/h1-3,5-6,8-11,13,18,23H,4,7,12,14-15H2 |
| InChIKey | LSEFYBIKLLXEGS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole?
The IUPAC name of 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole (CID 137466163) is 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole.
What is the SMILES notation for 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole?
The canonical SMILES for 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole is c1ccc(CN2CCCC(n3[nH]cc4ccc5nccc5c43)C2)cc1.
What is the InChIKey of 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole?
The InChIKey is LSEFYBIKLLXEGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4/c1-2-5-16(6-3-1)14-24-12-4-7-18(15-24)25-21-17(13-23-25)8-9-20-19(21)10-11-22-20/h1-3,5-6,8-11,13,18,23H,4,7,12,14-15H2.
What are the key properties of 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole?
1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole has a molecular weight of 330.44 g/mol, XLogP of 4.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzylpiperidin-3-yl)-2H-pyrrolo[2,3-g]indazole is sourced from PubChem (CID 137466163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).