C13H18N6 — CID 137466165
(1S,3R,4S)-3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-12-yl)cyclopentan-1-amine (PubChem CID 137466165) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is (1S,3R,4S)-3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-12-yl)cyclopentan-1-amine.
| Compound Name | (1S,3R,4S)-3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-12-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 137466165 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (1S,3R,4S)-3-methyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-12-yl)cyclopentan-1-amine |
| SMILES | C[C@@H]1C[C@H](N)C[C@@H]1c1nnc2n1C1C=CNC1N=C2 |
| InChI | InChI=1S/C13H18N6/c1-7-4-8(14)5-9(7)13-18-17-11-6-16-12-10(19(11)13)2-3-15-12/h2-3,6-10,12,15H,4-5,14H2,1H3/t7-,8+,9+,10?,12?/m1/s1 |
| InChIKey | BPFULYBGSQOTJS-FTWUNBTJSA-N |
| XLogP | 0.54 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |