C9H21N2O2P — CID 137466268
2-amino-3,5,5-trimethyl-6-(phosphanylamino)hexanoic acid (PubChem CID 137466268) has the molecular formula C9H21N2O2P and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-amino-3,5,5-trimethyl-6-(phosphanylamino)hexanoic acid.
| Compound Name | 2-amino-3,5,5-trimethyl-6-(phosphanylamino)hexanoic acid |
|---|---|
| PubChem CID | 137466268 |
| Molecular Formula | C9H21N2O2P |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-amino-3,5,5-trimethyl-6-(phosphanylamino)hexanoic acid |
| SMILES | CC(CC(C)(C)CNP)C(N)C(=O)O |
| InChI | InChI=1S/C9H21N2O2P/c1-6(7(10)8(12)13)4-9(2,3)5-11-14/h6-7,11H,4-5,10,14H2,1-3H3,(H,12,13) |
| InChIKey | NSNZZTRQPKAFRL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|