About 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate
1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate (PubChem CID 137466270) has the molecular formula C15H22O7
and a molecular weight of 314.33 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate |
| PubChem CID | 137466270 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate |
| SMILES | C=C(O)C(=O)OC(C)CC(C)(C)OC(=O)C(=C)C(=O)OCC |
| InChI | InChI=1S/C15H22O7/c1-7-20-12(17)10(3)13(18)22-15(5,6)8-9(2)21-14(19)11(4)16/h9,16H,3-4,7-8H2,1-2,5-6H3 |
| InChIKey | LNSZSYPXSSGQDY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate?
The IUPAC name of 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate (CID 137466270) is 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate?
The canonical SMILES for 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate is C=C(O)C(=O)OC(C)CC(C)(C)OC(=O)C(=C)C(=O)OCC.
What is the InChIKey of 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate?
The InChIKey is LNSZSYPXSSGQDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O7/c1-7-20-12(17)10(3)13(18)22-15(5,6)8-9(2)21-14(19)11(4)16/h9,16H,3-4,7-8H2,1-2,5-6H3.
What are the key properties of 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate?
1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate has a molecular weight of 314.33 g/mol, XLogP of 1.82, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-[4-(2-hydroxyprop-2-enoyloxy)-2-methylpentan-2-yl] 2-methylidenepropanedioate is sourced from PubChem (CID 137466270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).