C10H14N2 — CID 137466735
2,6,7-trimethyl-3a,4-dihydro-1H-benzimidazole (PubChem CID 137466735) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,6,7-trimethyl-3a,4-dihydro-1H-benzimidazole.
| Compound Name | 2,6,7-trimethyl-3a,4-dihydro-1H-benzimidazole |
|---|---|
| PubChem CID | 137466735 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,6,7-trimethyl-3a,4-dihydro-1H-benzimidazole |
| SMILES | CC1=CCC2N=C(C)NC2=C1C |
| InChI | InChI=1S/C10H14N2/c1-6-4-5-9-10(7(6)2)12-8(3)11-9/h4,9H,5H2,1-3H3,(H,11,12) |
| InChIKey | XZBPWAPYHKHWLH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |