About 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole
2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole (PubChem CID 137466736) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole |
| PubChem CID | 137466736 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole |
| SMILES | Cc1nc2c([nH]1)=CC=CC(C)C=2 |
| InChI | InChI=1S/C10H12N2/c1-7-4-3-5-9-10(6-7)12-8(2)11-9/h3-7H,1-2H3,(H,11,12) |
| InChIKey | URSNDQPDLBAKKB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole?
The IUPAC name of 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole (CID 137466736) is 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole.
What is the SMILES notation for 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole?
The canonical SMILES for 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole is Cc1nc2c([nH]1)=CC=CC(C)C=2.
What is the InChIKey of 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole?
The InChIKey is URSNDQPDLBAKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-4-3-5-9-10(6-7)12-8(2)11-9/h3-7H,1-2H3,(H,11,12).
What are the key properties of 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole?
2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole has a molecular weight of 160.22 g/mol, XLogP of 0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,5-dihydrocyclohepta[d]imidazole is sourced from PubChem (CID 137466736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).