C47H36N2 — CID 137466972
(Z)-2-[5-[3-[10-(1,8a-dihydronaphthalen-1-yl)anthracen-9-yl]phenyl]-3-methyl-1-phenylindol-2-yl]ethenamine (PubChem CID 137466972) has the molecular formula C47H36N2 and a molecular weight of 628.82 g/mol. Its IUPAC name is (Z)-2-[5-[3-[10-(1,8a-dihydronaphthalen-1-yl)anthracen-9-yl]phenyl]-3-methyl-1-phenylindol-2-yl]ethenamine.
| Compound Name | (Z)-2-[5-[3-[10-(1,8a-dihydronaphthalen-1-yl)anthracen-9-yl]phenyl]-3-methyl-1-phenylindol-2-yl]ethenamine |
|---|---|
| PubChem CID | 137466972 |
| Molecular Formula | C47H36N2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | (Z)-2-[5-[3-[10-(1,8a-dihydronaphthalen-1-yl)anthracen-9-yl]phenyl]-3-methyl-1-phenylindol-2-yl]ethenamine |
| SMILES | Cc1c(/C=C\N)n(-c2ccccc2)c2ccc(-c3cccc(-c4c5ccccc5c(C5C=CC=C6C=CC=CC65)c5ccccc45)c3)cc12 |
| InChI | InChI=1S/C47H36N2/c1-31-43-30-34(25-26-45(43)49(44(31)27-28-48)36-17-3-2-4-18-36)33-15-11-16-35(29-33)46-39-20-7-9-22-41(39)47(42-23-10-8-21-40(42)46)38-24-12-14-32-13-5-6-19-37(32)38/h2-30,37-38H,48H2,1H3/b28-27- |
| InChIKey | ZLHVZIVHNIQDBP-DQSJHHFOSA-N |
| XLogP | 11.83 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|