C9H11Cl2N — CID 137467326
(4Z,6Z)-5,8-dichloronona-4,6-dien-2-yn-4-amine (PubChem CID 137467326) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is (4Z,6Z)-5,8-dichloronona-4,6-dien-2-yn-4-amine.
| Compound Name | (4Z,6Z)-5,8-dichloronona-4,6-dien-2-yn-4-amine |
|---|---|
| PubChem CID | 137467326 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | (4Z,6Z)-5,8-dichloronona-4,6-dien-2-yn-4-amine |
| SMILES | CC#C/C(N)=C(Cl)\C=C/C(C)Cl |
| InChI | InChI=1S/C9H11Cl2N/c1-3-4-9(12)8(11)6-5-7(2)10/h5-7H,12H2,1-2H3/b6-5-,9-8- |
| InChIKey | GVTVGQASKNOMGZ-AFJQJTPPSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|