C19H26N2S — CID 137467473
1-[2-[(Z)-5-methyloct-5-en-2-yn-4-yl]sulfanylcyclohexa-1,3,4-trien-1-yl]piperazine (PubChem CID 137467473) has the molecular formula C19H26N2S and a molecular weight of 314.50 g/mol. Its IUPAC name is 1-[2-[(Z)-5-methyloct-5-en-2-yn-4-yl]sulfanylcyclohexa-1,3,4-trien-1-yl]piperazine.
| Compound Name | 1-[2-[(Z)-5-methyloct-5-en-2-yn-4-yl]sulfanylcyclohexa-1,3,4-trien-1-yl]piperazine |
|---|---|
| PubChem CID | 137467473 |
| Molecular Formula | C19H26N2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-[2-[(Z)-5-methyloct-5-en-2-yn-4-yl]sulfanylcyclohexa-1,3,4-trien-1-yl]piperazine |
| SMILES | CC#CC(SC1=C(N2CCNCC2)CC=C=C1)/C(C)=C\CC |
| InChI | InChI=1S/C19H26N2S/c1-4-8-16(3)18(9-5-2)22-19-11-7-6-10-17(19)21-14-12-20-13-15-21/h6,8,11,18,20H,4,10,12-15H2,1-3H3/b16-8- |
| InChIKey | VKNFYCNDMHFZQS-PXNMLYILSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|