C18H27N — CID 137467591
N-[(1Z,3E)-5-cyclohexa-1,3-dien-1-yl-4-ethyl-6,6-dimethylhepta-1,3-dienyl]methanimine (PubChem CID 137467591) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is N-[(1Z,3E)-5-cyclohexa-1,3-dien-1-yl-4-ethyl-6,6-dimethylhepta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-5-cyclohexa-1,3-dien-1-yl-4-ethyl-6,6-dimethylhepta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 137467591 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-[(1Z,3E)-5-cyclohexa-1,3-dien-1-yl-4-ethyl-6,6-dimethylhepta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C=C(/CC)C(C1=CC=CCC1)C(C)(C)C |
| InChI | InChI=1S/C18H27N/c1-6-15(13-10-14-19-5)17(18(2,3)4)16-11-8-7-9-12-16/h7-8,10-11,13-14,17H,5-6,9,12H2,1-4H3/b14-10-,15-13+ |
| InChIKey | XRYAIKLOJHLQFO-IPIYPREKSA-N |
| XLogP | 5.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|