C18H30F2N2O2 — CID 137467748
tert-butyl N-[1-[(3E,5Z)-2,2-difluoro-3-methylhepta-3,5-dienyl]piperidin-4-yl]carbamate (PubChem CID 137467748) has the molecular formula C18H30F2N2O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is tert-butyl N-[1-[(3E,5Z)-2,2-difluoro-3-methylhepta-3,5-dienyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3E,5Z)-2,2-difluoro-3-methylhepta-3,5-dienyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 137467748 |
| Molecular Formula | C18H30F2N2O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | tert-butyl N-[1-[(3E,5Z)-2,2-difluoro-3-methylhepta-3,5-dienyl]piperidin-4-yl]carbamate |
| SMILES | C/C=C\C=C(/C)C(F)(F)CN1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30F2N2O2/c1-6-7-8-14(2)18(19,20)13-22-11-9-15(10-12-22)21-16(23)24-17(3,4)5/h6-8,15H,9-13H2,1-5H3,(H,21,23)/b7-6-,14-8+ |
| InChIKey | JPAVBVCPYMJJOV-BHWOWGIZSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|