C13H22FN — CID 137467773
(5Z,7E)-5-ethenyl-8-fluoro-N,N,3-trimethylocta-5,7-dien-2-amine (PubChem CID 137467773) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is (5Z,7E)-5-ethenyl-8-fluoro-N,N,3-trimethylocta-5,7-dien-2-amine.
| Compound Name | (5Z,7E)-5-ethenyl-8-fluoro-N,N,3-trimethylocta-5,7-dien-2-amine |
|---|---|
| PubChem CID | 137467773 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (5Z,7E)-5-ethenyl-8-fluoro-N,N,3-trimethylocta-5,7-dien-2-amine |
| SMILES | C=C/C(=C\C=C\F)CC(C)C(C)N(C)C |
| InChI | InChI=1S/C13H22FN/c1-6-13(8-7-9-14)10-11(2)12(3)15(4)5/h6-9,11-12H,1,10H2,2-5H3/b9-7+,13-8+ |
| InChIKey | PJVKKOBGIVPVIY-AVPQAVFTSA-N |
| XLogP | 3.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|