About (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine
(6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine (PubChem CID 137467897) has the molecular formula C9H10F3N
and a molecular weight of 189.18 g/mol. Its IUPAC name is (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine.
Molecular Properties
| Compound Name | (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine |
| PubChem CID | 137467897 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine |
| SMILES | CC1C=CC/C=C(C(F)(F)F)\C=N/1 |
| InChI | InChI=1S/C9H10F3N/c1-7-4-2-3-5-8(6-13-7)9(10,11)12/h2,4-7H,3H2,1H3/b4-2?,8-5+,13-6- |
| InChIKey | LENKRIJRADRZBB-SIUJRAKMSA-N |
| XLogP | 2.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine?
The IUPAC name of (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine (CID 137467897) is (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine.
What is the SMILES notation for (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine?
The canonical SMILES for (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine is CC1C=CC/C=C(C(F)(F)F)\C=N/1.
What is the InChIKey of (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine?
The InChIKey is LENKRIJRADRZBB-SIUJRAKMSA-N. The full InChI is InChI=1S/C9H10F3N/c1-7-4-2-3-5-8(6-13-7)9(10,11)12/h2,4-7H,3H2,1H3/b4-2?,8-5+,13-6-.
What are the key properties of (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine?
(6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine has a molecular weight of 189.18 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-2-methyl-7-(trifluoromethyl)-2,5-dihydroazocine is sourced from PubChem (CID 137467897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).