C17H26N6O3 — CID 137467954
5-cyclopropyl-5-[3-[4-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 137467954) has the molecular formula C17H26N6O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 5-cyclopropyl-5-[3-[4-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-5-[3-[4-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137467954 |
| Molecular Formula | C17H26N6O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 5-cyclopropyl-5-[3-[4-[(1E,3Z)-1,4-diaminobuta-1,3-dienyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | N/C=C\C=C(/N)N1CCN(C(=O)CCC2(C3CC3)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C17H26N6O3/c18-7-1-2-13(19)22-8-10-23(11-9-22)14(24)5-6-17(12-3-4-12)15(25)20-16(26)21-17/h1-2,7,12H,3-6,8-11,18-19H2,(H2,20,21,25,26)/b7-1-,13-2+ |
| InChIKey | UOYDYNHXLZGSQH-QVVJNCLRSA-N |
| XLogP | -0.83 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|