C21H29ClN4O3 — CID 137468144
5-[3-[4-[(2E,4E)-5-chloro-4-methylhepta-2,4,6-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione (PubChem CID 137468144) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is 5-[3-[4-[(2E,4E)-5-chloro-4-methylhepta-2,4,6-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-[(2E,4E)-5-chloro-4-methylhepta-2,4,6-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137468144 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 5-[3-[4-[(2E,4E)-5-chloro-4-methylhepta-2,4,6-trien-3-yl]piperazin-1-yl]-3-oxopropyl]-5-cyclopropylimidazolidine-2,4-dione |
| SMILES | C=C/C(Cl)=C(C)\C(=C/C)N1CCN(C(=O)CCC2(C3CC3)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C21H29ClN4O3/c1-4-16(22)14(3)17(5-2)25-10-12-26(13-11-25)18(27)8-9-21(15-6-7-15)19(28)23-20(29)24-21/h4-5,15H,1,6-13H2,2-3H3,(H2,23,24,28,29)/b16-14+,17-5+ |
| InChIKey | RXVCYXOLVIVSJM-OIBWNNAUSA-N |
| XLogP | 2.50 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|