C16H18Cl2N4O3 — CID 137468159
(5R)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 137468159) has the molecular formula C16H18Cl2N4O3 and a molecular weight of 385.25 g/mol. Its IUPAC name is (5R)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137468159 |
| Molecular Formula | C16H18Cl2N4O3 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (5R)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H](CCC(=O)N2CCN(c3cc(Cl)cc(Cl)c3)CC2)N1 |
| InChI | InChI=1S/C16H18Cl2N4O3/c17-10-7-11(18)9-12(8-10)21-3-5-22(6-4-21)14(23)2-1-13-15(24)20-16(25)19-13/h7-9,13H,1-6H2,(H2,19,20,24,25)/t13-/m1/s1 |
| InChIKey | YINSFKOGVSNIAY-CYBMUJFWSA-N |
| XLogP | 1.63 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|