C23H20ClFN2O2S — CID 137468343
2-[3-chloro-6-[(3Z,5E)-5-fluoroocta-3,5-dien-7-yn-4-yl]-1-benzothiophene-2-carbonyl]-2,5-diazaspiro[3.4]octan-6-one (PubChem CID 137468343) has the molecular formula C23H20ClFN2O2S and a molecular weight of 442.94 g/mol. Its IUPAC name is 2-[3-chloro-6-[(3Z,5E)-5-fluoroocta-3,5-dien-7-yn-4-yl]-1-benzothiophene-2-carbonyl]-2,5-diazaspiro[3.4]octan-6-one.
| Compound Name | 2-[3-chloro-6-[(3Z,5E)-5-fluoroocta-3,5-dien-7-yn-4-yl]-1-benzothiophene-2-carbonyl]-2,5-diazaspiro[3.4]octan-6-one |
|---|---|
| PubChem CID | 137468343 |
| Molecular Formula | C23H20ClFN2O2S |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 2-[3-chloro-6-[(3Z,5E)-5-fluoroocta-3,5-dien-7-yn-4-yl]-1-benzothiophene-2-carbonyl]-2,5-diazaspiro[3.4]octan-6-one |
| SMILES | C#C/C=C(F)\C(=C/CC)c1ccc2c(Cl)c(C(=O)N3CC4(CCC(=O)N4)C3)sc2c1 |
| InChI | InChI=1S/C23H20ClFN2O2S/c1-3-5-15(17(25)6-4-2)14-7-8-16-18(11-14)30-21(20(16)24)22(29)27-12-23(13-27)10-9-19(28)26-23/h2,5-8,11H,3,9-10,12-13H2,1H3,(H,26,28)/b15-5-,17-6+ |
| InChIKey | TWSXEMWNHGRGDS-KSDLVNQGSA-N |
| XLogP | 4.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|