About 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine
6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine (PubChem CID 137468450) has the molecular formula C7H9F3N2
and a molecular weight of 178.16 g/mol. Its IUPAC name is 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine.
Molecular Properties
| Compound Name | 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine |
| PubChem CID | 137468450 |
| Molecular Formula | C7H9F3N2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine |
| SMILES | CC1=C(N)C=C(C(F)(F)F)CN1 |
| InChI | InChI=1S/C7H9F3N2/c1-4-6(11)2-5(3-12-4)7(8,9)10/h2,12H,3,11H2,1H3 |
| InChIKey | KQLWQPZLFUJIEN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine?
The IUPAC name of 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine (CID 137468450) is 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine.
What is the SMILES notation for 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine?
The canonical SMILES for 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine is CC1=C(N)C=C(C(F)(F)F)CN1.
What is the InChIKey of 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine?
The InChIKey is KQLWQPZLFUJIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2/c1-4-6(11)2-5(3-12-4)7(8,9)10/h2,12H,3,11H2,1H3.
What are the key properties of 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine?
6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine has a molecular weight of 178.16 g/mol, XLogP of 1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-(trifluoromethyl)-1,2-dihydropyridin-5-amine is sourced from PubChem (CID 137468450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).