C17H28N2 — CID 137468664
(3E,5E)-5-cyclopentyl-N,4-dimethyl-6-(methylideneamino)-3-prop-1-en-2-ylhexa-3,5-dien-1-amine (PubChem CID 137468664) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is (3E,5E)-5-cyclopentyl-N,4-dimethyl-6-(methylideneamino)-3-prop-1-en-2-ylhexa-3,5-dien-1-amine.
| Compound Name | (3E,5E)-5-cyclopentyl-N,4-dimethyl-6-(methylideneamino)-3-prop-1-en-2-ylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 137468664 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (3E,5E)-5-cyclopentyl-N,4-dimethyl-6-(methylideneamino)-3-prop-1-en-2-ylhexa-3,5-dien-1-amine |
| SMILES | C=N/C=C(C(/C)=C(\CCNC)C(=C)C)\C1CCCC1 |
| InChI | InChI=1S/C17H28N2/c1-13(2)16(10-11-18-4)14(3)17(12-19-5)15-8-6-7-9-15/h12,15,18H,1,5-11H2,2-4H3/b16-14+,17-12- |
| InChIKey | UFVQERSHRVTLSG-XKOSHKPESA-N |
| XLogP | 4.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|