About 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde
2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde (PubChem CID 137468836) has the molecular formula C11H16O3S
and a molecular weight of 228.31 g/mol. Its IUPAC name is 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde |
| PubChem CID | 137468836 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde |
| SMILES | CC(C)S(=O)(=O)C1=CCC(CC=O)C=C1 |
| InChI | InChI=1S/C11H16O3S/c1-9(2)15(13,14)11-5-3-10(4-6-11)7-8-12/h3,5-6,8-10H,4,7H2,1-2H3 |
| InChIKey | FQTZPBTUFAEZLM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The IUPAC name of 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde (CID 137468836) is 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde.
What is the SMILES notation for 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The canonical SMILES for 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde is CC(C)S(=O)(=O)C1=CCC(CC=O)C=C1.
What is the InChIKey of 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The InChIKey is FQTZPBTUFAEZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3S/c1-9(2)15(13,14)11-5-3-10(4-6-11)7-8-12/h3,5-6,8-10H,4,7H2,1-2H3.
What are the key properties of 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde?
2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde has a molecular weight of 228.31 g/mol, XLogP of 1.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propan-2-ylsulfonylcyclohexa-2,4-dien-1-yl)acetaldehyde is sourced from PubChem (CID 137468836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).