C33H34Cl2FN9O4 — CID 137469581
4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(tetrazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-3-fluorophenyl]piperazin-1-yl]phenyl]-2-propyl-1,2,4-triazol-3-one (PubChem CID 137469581) has the molecular formula C33H34Cl2FN9O4 and a molecular weight of 710.60 g/mol. Its IUPAC name is 4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(tetrazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-3-fluorophenyl]piperazin-1-yl]phenyl]-2-propyl-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(tetrazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-3-fluorophenyl]piperazin-1-yl]phenyl]-2-propyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 137469581 |
| Molecular Formula | C33H34Cl2FN9O4 |
| Molecular Weight | 710.60 g/mol |
| Exact Mass | 709.21 |
| IUPAC Name | 4-[4-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(tetrazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]-3-fluorophenyl]piperazin-1-yl]phenyl]-2-propyl-1,2,4-triazol-3-one |
| SMILES | CCCn1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6cnnn6)(c6ccc(Cl)cc6Cl)O5)c(F)c4)CC3)cc2)c1=O |
| InChI | InChI=1S/C33H34Cl2FN9O4/c1-2-11-45-32(46)44(22-38-45)25-6-4-24(5-7-25)41-12-14-42(15-13-41)26-8-10-31(30(36)17-26)47-18-27-19-48-33(49-27,20-43-21-37-39-40-43)28-9-3-23(34)16-29(28)35/h3-10,16-17,21-22,27H,2,11-15,18-20H2,1H3/t27-,33-/m1/s1 |
| InChIKey | SKVYBYQSJBWDPC-ZORMNXRFSA-N |
| XLogP | 4.55 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|