C20H24N4O3 — CID 1374696
2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]benzamide (PubChem CID 1374696) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 1374696 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]benzamide |
| SMILES | COc1ccc(N2CCN(CC(=O)Nc3ccccc3C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O3/c1-27-16-8-6-15(7-9-16)24-12-10-23(11-13-24)14-19(25)22-18-5-3-2-4-17(18)20(21)26/h2-9H,10-14H2,1H3,(H2,21,26)(H,22,25) |
| InChIKey | IXCRHZBEKCRBDX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|