C18H25F2NO — CID 137469880
3,3-difluoro-1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one (PubChem CID 137469880) has the molecular formula C18H25F2NO and a molecular weight of 309.40 g/mol. Its IUPAC name is 3,3-difluoro-1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one.
| Compound Name | 3,3-difluoro-1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one |
|---|---|
| PubChem CID | 137469880 |
| Molecular Formula | C18H25F2NO |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 3,3-difluoro-1-[(6S)-6-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,6-dihydro-2H-pyridin-1-yl]-2,2-dimethylbutan-1-one |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1C=CCCN1C(=O)C(C)(C)C(C)(F)F |
| InChI | InChI=1S/C18H25F2NO/c1-6-7-8-11-14(2)15-12-9-10-13-21(15)16(22)17(3,4)18(5,19)20/h6-9,11-12,15H,2,10,13H2,1,3-5H3/b7-6-,11-8-/t15-/m0/s1 |
| InChIKey | GYZOBBNANZZAAM-BXDGQQCYSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|