About (4Z)-3-ethenyliminohepta-4,6-dien-2-one
(4Z)-3-ethenyliminohepta-4,6-dien-2-one (PubChem CID 137469965) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is (4Z)-3-ethenyliminohepta-4,6-dien-2-one.
Molecular Properties
| Compound Name | (4Z)-3-ethenyliminohepta-4,6-dien-2-one |
| PubChem CID | 137469965 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (4Z)-3-ethenyliminohepta-4,6-dien-2-one |
| SMILES | C=C/C=C\C(=N\C=C)C(C)=O |
| InChI | InChI=1S/C9H11NO/c1-4-6-7-9(8(3)11)10-5-2/h4-7H,1-2H2,3H3/b7-6-,10-9- |
| InChIKey | AGHLLNIAZULGGO-HZJYTTRNSA-N |
| XLogP | 1.90 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-3-ethenyliminohepta-4,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-3-ethenyliminohepta-4,6-dien-2-one?
The IUPAC name of (4Z)-3-ethenyliminohepta-4,6-dien-2-one (CID 137469965) is (4Z)-3-ethenyliminohepta-4,6-dien-2-one.
What is the SMILES notation for (4Z)-3-ethenyliminohepta-4,6-dien-2-one?
The canonical SMILES for (4Z)-3-ethenyliminohepta-4,6-dien-2-one is C=C/C=C\C(=N\C=C)C(C)=O.
What is the InChIKey of (4Z)-3-ethenyliminohepta-4,6-dien-2-one?
The InChIKey is AGHLLNIAZULGGO-HZJYTTRNSA-N. The full InChI is InChI=1S/C9H11NO/c1-4-6-7-9(8(3)11)10-5-2/h4-7H,1-2H2,3H3/b7-6-,10-9-.
What are the key properties of (4Z)-3-ethenyliminohepta-4,6-dien-2-one?
(4Z)-3-ethenyliminohepta-4,6-dien-2-one has a molecular weight of 149.19 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-3-ethenyliminohepta-4,6-dien-2-one is sourced from PubChem (CID 137469965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).