C15H14F4N2OS — CID 137470142
2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2-tetrafluoroethoxymethyl)pyridine (PubChem CID 137470142) has the molecular formula C15H14F4N2OS and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2-tetrafluoroethoxymethyl)pyridine.
| Compound Name | 2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2-tetrafluoroethoxymethyl)pyridine |
|---|---|
| PubChem CID | 137470142 |
| Molecular Formula | C15H14F4N2OS |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-(3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2-tetrafluoroethoxymethyl)pyridine |
| SMILES | CCSc1cccnc1-c1ccc(COC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C15H14F4N2OS/c1-2-23-12-4-3-7-20-13(12)11-6-5-10(8-21-11)9-22-15(18,19)14(16)17/h3-8,14H,2,9H2,1H3 |
| InChIKey | YUXXEGFPLVKTRV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|