About 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine
3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine (PubChem CID 137470143) has the molecular formula C15H15F3N2O3S
and a molecular weight of 360.36 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine.
Molecular Properties
| Compound Name | 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine |
| PubChem CID | 137470143 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine |
| SMILES | CCS(=O)(=O)c1cccnc1-c1ccc(COCC(F)(F)F)cn1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-2-24(21,22)13-4-3-7-19-14(13)12-6-5-11(8-20-12)9-23-10-15(16,17)18/h3-8H,2,9-10H2,1H3 |
| InChIKey | RBLNOFSXJPUMCW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine?
The IUPAC name of 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine (CID 137470143) is 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine.
What is the SMILES notation for 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine?
The canonical SMILES for 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine is CCS(=O)(=O)c1cccnc1-c1ccc(COCC(F)(F)F)cn1.
What is the InChIKey of 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine?
The InChIKey is RBLNOFSXJPUMCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N2O3S/c1-2-24(21,22)13-4-3-7-19-14(13)12-6-5-11(8-20-12)9-23-10-15(16,17)18/h3-8H,2,9-10H2,1H3.
What are the key properties of 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine?
3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine has a molecular weight of 360.36 g/mol, XLogP of 3.02, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfonyl-2-[5-(2,2,2-trifluoroethoxymethyl)-2-pyridinyl]pyridine is sourced from PubChem (CID 137470143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).