About 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile
2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile (PubChem CID 137470419) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile.
Molecular Properties
| Compound Name | 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile |
| PubChem CID | 137470419 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile |
| SMILES | C=CCC(C#N)(CC)CCC(C#N)(CC=C)CC=C |
| InChI | InChI=1S/C17H24N2/c1-5-9-16(8-4,14-18)12-13-17(15-19,10-6-2)11-7-3/h5-7H,1-3,8-13H2,4H3 |
| InChIKey | OOTIDNUIPVBLTM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile?
The IUPAC name of 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile (CID 137470419) is 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile.
What is the SMILES notation for 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile?
The canonical SMILES for 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile is C=CCC(C#N)(CC)CCC(C#N)(CC=C)CC=C.
What is the InChIKey of 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile?
The InChIKey is OOTIDNUIPVBLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c1-5-9-16(8-4,14-18)12-13-17(15-19,10-6-2)11-7-3/h5-7H,1-3,8-13H2,4H3.
What are the key properties of 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile?
2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile has a molecular weight of 256.39 g/mol, XLogP of 4.92, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,5,5-tris(prop-2-enyl)hexanedinitrile is sourced from PubChem (CID 137470419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).