C21H21NO8 — CID 137470476
(3,4,5-trimethoxyphenyl) 5,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylate (PubChem CID 137470476) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) 5,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylate.
| Compound Name | (3,4,5-trimethoxyphenyl) 5,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 137470476 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) 5,7-dimethoxy-4-oxo-1H-quinoline-3-carboxylate |
| SMILES | COc1cc(OC)c2c(=O)c(C(=O)Oc3cc(OC)c(OC)c(OC)c3)c[nH]c2c1 |
| InChI | InChI=1S/C21H21NO8/c1-25-11-6-14-18(15(7-11)26-2)19(23)13(10-22-14)21(24)30-12-8-16(27-3)20(29-5)17(9-12)28-4/h6-10H,1-5H3,(H,22,23) |
| InChIKey | GWBDNJSIDKJKLR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|